C26H33N3O8S — CID 155513321
N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[3-(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylsulfanyl]oxan-3-yl]acetamide (PubChem CID 155513321) has the molecular formula C26H33N3O8S and a molecular weight of 547.63 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[3-(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylsulfanyl]oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[3-(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylsulfanyl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 155513321 |
| Molecular Formula | C26H33N3O8S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[3-(6-methoxy-1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylsulfanyl]oxan-3-yl]acetamide |
| SMILES | COc1ccc2c3c(cccc13)C(=O)N(CCCNCCS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O)C2=O |
| InChI | InChI=1S/C26H33N3O8S/c1-14(31)28-21-23(33)22(32)19(13-30)37-26(21)38-12-10-27-9-4-11-29-24(34)16-6-3-5-15-18(36-2)8-7-17(20(15)16)25(29)35/h3,5-8,19,21-23,26-27,30,32-33H,4,9-13H2,1-2H3,(H,28,31)/t19-,21-,22-,23-,26+/m1/s1 |
| InChIKey | CRSUKZHNUMRQBT-ILRYNQFESA-N |
| XLogP | 0.10 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|