C31H46O5 — CID 155513354
3,5-dihydroxy-4-[(1S,2S,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-2-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one (PubChem CID 155513354) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is 3,5-dihydroxy-4-[(1S,2S,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-2-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-4-[(1S,2S,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-2-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 155513354 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 3,5-dihydroxy-4-[(1S,2S,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]-2-(3-methylbutanoyl)-6,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@H](C2=C(O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C2O)C1 |
| InChI | InChI=1S/C31H46O5/c1-18(2)10-14-31(15-11-19(3)4)28(34)25(23-17-22(21(7)8)12-13-30(23,9)36)27(33)26(29(31)35)24(32)16-20(5)6/h10-11,20,22-23,33-34,36H,7,12-17H2,1-6,8-9H3/t22-,23+,30+/m1/s1 |
| InChIKey | XKDBBWBWCCXIPY-HFZPWKHCSA-N |
| XLogP | 7.25 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|