C27H36N6O3 — CID 155513434
1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea (PubChem CID 155513434) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 155513434 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[3-(5-methylimidazol-1-yl)propyl]-1-[1-(pyridin-3-ylmethyl)piperidin-4-yl]urea |
| SMILES | COc1ccc(N(C(=O)NCCCn2cncc2C)C2CCN(Cc3cccnc3)CC2)cc1OC |
| InChI | InChI=1S/C27H36N6O3/c1-21-17-29-20-32(21)13-5-12-30-27(34)33(24-7-8-25(35-2)26(16-24)36-3)23-9-14-31(15-10-23)19-22-6-4-11-28-18-22/h4,6-8,11,16-18,20,23H,5,9-10,12-15,19H2,1-3H3,(H,30,34) |
| InChIKey | UJGKZDGNSIYVOY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|