C31H27BF6N2O2 — CID 155513483
1-[4-[4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]piperazin-4-ium-1-yl]ethanone tetrafluoroborate (PubChem CID 155513483) has the molecular formula C31H27BF6N2O2 and a molecular weight of 584.37 g/mol. Its IUPAC name is 1-[4-[4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]piperazin-4-ium-1-yl]ethanone tetrafluoroborate.
| Compound Name | 1-[4-[4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]piperazin-4-ium-1-yl]ethanone tetrafluoroborate |
|---|---|
| PubChem CID | 155513483 |
| Molecular Formula | C31H27BF6N2O2 |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 1-[4-[4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]piperazin-4-ium-1-yl]ethanone tetrafluoroborate |
| SMILES | CC(=O)N1CC[N+](=C2C=CC(=C/C=C3\C=C(c4ccc(F)cc4)C=C(c4ccc(F)cc4)O3)C=C2)CC1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H27F2N2O2.BF4/c1-22(36)34-16-18-35(19-17-34)29-13-2-23(3-14-29)4-15-30-20-26(24-5-9-27(32)10-6-24)21-31(37-30)25-7-11-28(33)12-8-25;2-1(3,4)5/h2-15,20-21H,16-19H2,1H3;/q+1;-1/b30-15+; |
| InChIKey | ANWMVOOYDHWDNX-FEQJUTTQSA-N |
| XLogP | 6.97 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|