C23H19ClN2O3 — CID 155513486
1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-4-chloro-2,7-dihydroxy-5H-phenanthridin-6-one (PubChem CID 155513486) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-4-chloro-2,7-dihydroxy-5H-phenanthridin-6-one.
| Compound Name | 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-4-chloro-2,7-dihydroxy-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 155513486 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-4-chloro-2,7-dihydroxy-5H-phenanthridin-6-one |
| SMILES | NCC1(c2ccc(-c3c(O)cc(Cl)c4[nH]c(=O)c5c(O)cccc5c34)cc2)CC1 |
| InChI | InChI=1S/C23H19ClN2O3/c24-15-10-17(28)18(12-4-6-13(7-5-12)23(11-25)8-9-23)20-14-2-1-3-16(27)19(14)22(29)26-21(15)20/h1-7,10,27-28H,8-9,11,25H2,(H,26,29) |
| InChIKey | OLGXBLDIEDRTFD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|