About 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine
2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine (PubChem CID 155513551) has the molecular formula C22H30N4
and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine.
Molecular Properties
| Compound Name | 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine |
| PubChem CID | 155513551 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine |
| SMILES | c1ccc([C@H]([C@@H](c2ccccn2)N2CCCCC2)N2CCCCC2)nc1 |
| InChI | InChI=1S/C22H30N4/c1-7-15-25(16-8-1)21(19-11-3-5-13-23-19)22(20-12-4-6-14-24-20)26-17-9-2-10-18-26/h3-6,11-14,21-22H,1-2,7-10,15-18H2/t21-,22-/m1/s1 |
| InChIKey | QLTBRUVLRLFPSE-FGZHOGPDSA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine?
The IUPAC name of 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine (CID 155513551) is 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine.
What is the SMILES notation for 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine?
The canonical SMILES for 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine is c1ccc([C@H]([C@@H](c2ccccn2)N2CCCCC2)N2CCCCC2)nc1.
What is the InChIKey of 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine?
The InChIKey is QLTBRUVLRLFPSE-FGZHOGPDSA-N. The full InChI is InChI=1S/C22H30N4/c1-7-15-25(16-8-1)21(19-11-3-5-13-23-19)22(20-12-4-6-14-24-20)26-17-9-2-10-18-26/h3-6,11-14,21-22H,1-2,7-10,15-18H2/t21-,22-/m1/s1.
What are the key properties of 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine?
2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine has a molecular weight of 350.51 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S)-1,2-di(piperidin-1-yl)-2-pyridin-2-ylethyl]pyridine is sourced from PubChem (CID 155513551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).