About N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide
N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide (PubChem CID 155513647) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide.
Molecular Properties
| Compound Name | N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide |
| PubChem CID | 155513647 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide |
| SMILES | O=C(NCCCC[C@H]1CN=C(c2ccccc2)N1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O/c24-20(17-11-5-2-6-12-17)21-14-8-7-13-18-15-22-19(23-18)16-9-3-1-4-10-16/h1-6,9-12,18H,7-8,13-15H2,(H,21,24)(H,22,23)/t18-/m0/s1 |
| InChIKey | MVUAJZINPWEPIR-SFHVURJKSA-N |
| XLogP | 3.01 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide?
The IUPAC name of N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide (CID 155513647) is N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide.
What is the SMILES notation for N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide?
The canonical SMILES for N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide is O=C(NCCCC[C@H]1CN=C(c2ccccc2)N1)c1ccccc1.
What is the InChIKey of N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide?
The InChIKey is MVUAJZINPWEPIR-SFHVURJKSA-N. The full InChI is InChI=1S/C20H23N3O/c24-20(17-11-5-2-6-12-17)21-14-8-7-13-18-15-22-19(23-18)16-9-3-1-4-10-16/h1-6,9-12,18H,7-8,13-15H2,(H,21,24)(H,22,23)/t18-/m0/s1.
What are the key properties of N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide?
N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide has a molecular weight of 321.42 g/mol, XLogP of 3.01, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5S)-2-phenyl-4,5-dihydro-1H-imidazol-5-yl]butyl]benzamide is sourced from PubChem (CID 155513647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).