C22H20FN7O2 — CID 155513662
(2S,3S)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-9-methylpurin-6-yl]amino]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 155513662) has the molecular formula C22H20FN7O2 and a molecular weight of 433.45 g/mol. Its IUPAC name is (2S,3S)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-9-methylpurin-6-yl]amino]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-9-methylpurin-6-yl]amino]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 155513662 |
| Molecular Formula | C22H20FN7O2 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2S,3S)-3-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-9-methylpurin-6-yl]amino]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | Cn1cnc2c(N[C@H]3C4C=CC(CC4)[C@@H]3C(=O)O)nc(-c3c[nH]c4ncc(F)cc34)nc21 |
| InChI | InChI=1S/C22H20FN7O2/c1-30-9-26-17-20(27-16-11-4-2-10(3-5-11)15(16)22(31)32)28-19(29-21(17)30)14-8-25-18-13(14)6-12(23)7-24-18/h2,4,6-11,15-16H,3,5H2,1H3,(H,24,25)(H,31,32)(H,27,28,29)/t10?,11?,15-,16-/m0/s1 |
| InChIKey | QLTCXURUOWTFQK-VVUBSENTSA-N |
| XLogP | 3.12 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|