C21H17FN2O — CID 155513688
(6aS,7R,12aS)-2-fluoro-7-phenyl-6a,7,12,12a-tetrahydro-6H-chromeno[4,3-b][1,5]naphthyridine (PubChem CID 155513688) has the molecular formula C21H17FN2O and a molecular weight of 332.38 g/mol. Its IUPAC name is (6aS,7R,12aS)-2-fluoro-7-phenyl-6a,7,12,12a-tetrahydro-6H-chromeno[4,3-b][1,5]naphthyridine.
| Compound Name | (6aS,7R,12aS)-2-fluoro-7-phenyl-6a,7,12,12a-tetrahydro-6H-chromeno[4,3-b][1,5]naphthyridine |
|---|---|
| PubChem CID | 155513688 |
| Molecular Formula | C21H17FN2O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (6aS,7R,12aS)-2-fluoro-7-phenyl-6a,7,12,12a-tetrahydro-6H-chromeno[4,3-b][1,5]naphthyridine |
| SMILES | Fc1ccc2c(c1)[C@H]1Nc3cccnc3[C@@H](c3ccccc3)[C@@H]1CO2 |
| InChI | InChI=1S/C21H17FN2O/c22-14-8-9-18-15(11-14)20-16(12-25-18)19(13-5-2-1-3-6-13)21-17(24-20)7-4-10-23-21/h1-11,16,19-20,24H,12H2/t16-,19-,20+/m0/s1 |
| InChIKey | NCLLNXUAQBYZDL-FFZOFVMBSA-N |
| XLogP | 4.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |