C30H37NO7S — CID 155513801
3-[3-[(1R,5S,6R,7S,9S,10S)-3-cyclohexylsulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 155513801) has the molecular formula C30H37NO7S and a molecular weight of 555.69 g/mol. Its IUPAC name is 3-[3-[(1R,5S,6R,7S,9S,10S)-3-cyclohexylsulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-cyclohexylsulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 155513801 |
| Molecular Formula | C30H37NO7S |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-cyclohexylsulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | C[C@]12C[C@@]34C=C(SC5CCCCC5)C(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2 |
| InChI | InChI=1S/C30H37NO7S/c1-28(11-10-22(33)31-23-19(32)9-8-18(24(23)34)27(36)37)25-20-12-16-13-30(25,15-29(16,2)38-20)14-21(26(28)35)39-17-6-4-3-5-7-17/h8-9,14,16-17,20,25,32,34H,3-7,10-13,15H2,1-2H3,(H,31,33)(H,36,37)/t16-,20+,25+,28+,29+,30-/m1/s1 |
| InChIKey | SCJVPWAHQLDWRY-BSZAXCLYSA-N |
| XLogP | 5.63 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|