About [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone
[4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 155513893) has the molecular formula C19H20N4O3
and a molecular weight of 352.39 g/mol. Its IUPAC name is [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone |
| PubChem CID | 155513893 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN(c3nc4cc(N)ccc4o3)CC2)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-25-15-4-2-3-13(11-15)18(24)22-7-9-23(10-8-22)19-21-16-12-14(20)5-6-17(16)26-19/h2-6,11-12H,7-10,20H2,1H3 |
| InChIKey | UEODAJCUTWAUHT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone?
The IUPAC name of [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone (CID 155513893) is [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone.
What is the SMILES notation for [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone?
The canonical SMILES for [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone is COc1cccc(C(=O)N2CCN(c3nc4cc(N)ccc4o3)CC2)c1.
What is the InChIKey of [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone?
The InChIKey is UEODAJCUTWAUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3/c1-25-15-4-2-3-13(11-15)18(24)22-7-9-23(10-8-22)19-21-16-12-14(20)5-6-17(16)26-19/h2-6,11-12H,7-10,20H2,1H3.
What are the key properties of [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone?
[4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone has a molecular weight of 352.39 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-amino-1,3-benzoxazol-2-yl)piperazin-1-yl]-(3-methoxyphenyl)methanone is sourced from PubChem (CID 155513893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).