C25H24N2O2 — CID 155513898
1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-2-methoxy-4-methyl-5H-phenanthridin-6-one (PubChem CID 155513898) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-2-methoxy-4-methyl-5H-phenanthridin-6-one.
| Compound Name | 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-2-methoxy-4-methyl-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 155513898 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-2-methoxy-4-methyl-5H-phenanthridin-6-one |
| SMILES | COc1cc(C)c2[nH]c(=O)c3ccccc3c2c1-c1ccc(C2(CN)CC2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-15-13-20(29-2)21(16-7-9-17(10-8-16)25(14-26)11-12-25)22-18-5-3-4-6-19(18)24(28)27-23(15)22/h3-10,13H,11-12,14,26H2,1-2H3,(H,27,28) |
| InChIKey | CJWCYEUAMHZNHR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|