C18H22N4 — CID 155513923
N'-[5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl]ethanimidamide (PubChem CID 155513923) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is N'-[5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl]ethanimidamide.
| Compound Name | N'-[5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl]ethanimidamide |
|---|---|
| PubChem CID | 155513923 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N'-[5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl]ethanimidamide |
| SMILES | C/C(N)=N\c1cc2c(c(-c3cccc(C)c3C)n1)CCCN2 |
| InChI | InChI=1S/C18H22N4/c1-11-6-4-7-14(12(11)2)18-15-8-5-9-20-16(15)10-17(22-18)21-13(3)19/h4,6-7,10,20H,5,8-9H2,1-3H3,(H2,19,21,22) |
| InChIKey | VDURWVXUFZBFJR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|