C27H25N5O3S — CID 155513942
N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide (PubChem CID 155513942) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide.
| Compound Name | N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 155513942 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C27H25N5O3S/c33-26(29-14-15-32-36(34,35)25-3-1-2-22-17-28-12-11-24(22)25)9-6-19-4-7-20(8-5-19)23-16-21-10-13-30-27(21)31-18-23/h1-5,7-8,10-13,16-18,32H,6,9,14-15H2,(H,29,33)(H,30,31) |
| InChIKey | RUMUZHMWTQIHMP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|