C23H24FN5O6S — CID 155513958
4-[3-(8-methoxy-2,4-dioxo-3-propylpurino[7,8-a]pyridin-1-yl)propylcarbamoyl]benzenesulfonyl fluoride (PubChem CID 155513958) has the molecular formula C23H24FN5O6S and a molecular weight of 517.54 g/mol. Its IUPAC name is 4-[3-(8-methoxy-2,4-dioxo-3-propylpurino[7,8-a]pyridin-1-yl)propylcarbamoyl]benzenesulfonyl fluoride.
| Compound Name | 4-[3-(8-methoxy-2,4-dioxo-3-propylpurino[7,8-a]pyridin-1-yl)propylcarbamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 155513958 |
| Molecular Formula | C23H24FN5O6S |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 4-[3-(8-methoxy-2,4-dioxo-3-propylpurino[7,8-a]pyridin-1-yl)propylcarbamoyl]benzenesulfonyl fluoride |
| SMILES | CCCn1c(=O)c2c(nc3cc(OC)ccn32)n(CCCNC(=O)c2ccc(S(=O)(=O)F)cc2)c1=O |
| InChI | InChI=1S/C23H24FN5O6S/c1-3-11-29-22(31)19-20(26-18-14-16(35-2)9-13-27(18)19)28(23(29)32)12-4-10-25-21(30)15-5-7-17(8-6-15)36(24,33)34/h5-9,13-14H,3-4,10-12H2,1-2H3,(H,25,30) |
| InChIKey | QNCALQNHCSHYFR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|