C21H28Cl2N4S — CID 155513965
6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine (PubChem CID 155513965) has the molecular formula C21H28Cl2N4S and a molecular weight of 439.46 g/mol. Its IUPAC name is 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine.
| Compound Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 155513965 |
| Molecular Formula | C21H28Cl2N4S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine |
| SMILES | Clc1cccc(N2CCN(CCCCN3CCc4ncsc4CC3)CC2)c1Cl |
| InChI | InChI=1S/C21H28Cl2N4S/c22-17-4-3-5-19(21(17)23)27-14-12-26(13-15-27)9-2-1-8-25-10-6-18-20(7-11-25)28-16-24-18/h3-5,16H,1-2,6-15H2 |
| InChIKey | PWBXUBVXWIRMLW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|