C31H35N5O5S — CID 155513975
(E)-3-(9-benzyl-6-morpholin-4-yl-2-propylsulfanylpurin-8-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 155513975) has the molecular formula C31H35N5O5S and a molecular weight of 589.72 g/mol. Its IUPAC name is (E)-3-(9-benzyl-6-morpholin-4-yl-2-propylsulfanylpurin-8-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(9-benzyl-6-morpholin-4-yl-2-propylsulfanylpurin-8-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155513975 |
| Molecular Formula | C31H35N5O5S |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (E)-3-(9-benzyl-6-morpholin-4-yl-2-propylsulfanylpurin-8-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCCSc1nc(N2CCOCC2)c2nc(/C=C/C(=O)c3cc(OC)c(OC)c(OC)c3)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C31H35N5O5S/c1-5-17-42-31-33-29(35-13-15-41-16-14-35)27-30(34-31)36(20-21-9-7-6-8-10-21)26(32-27)12-11-23(37)22-18-24(38-2)28(40-4)25(19-22)39-3/h6-12,18-19H,5,13-17,20H2,1-4H3/b12-11+ |
| InChIKey | ZRLHBKLBNJHKBZ-VAWYXSNFSA-N |
| XLogP | 5.14 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|