C13H23F3N2O3S3 — CID 155514102
piperidin-4-yl N-(4-methylsulfinylbutyl)carbamodithioate;2,2,2-trifluoroacetic acid (PubChem CID 155514102) has the molecular formula C13H23F3N2O3S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is piperidin-4-yl N-(4-methylsulfinylbutyl)carbamodithioate;2,2,2-trifluoroacetic acid.
| Compound Name | piperidin-4-yl N-(4-methylsulfinylbutyl)carbamodithioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155514102 |
| Molecular Formula | C13H23F3N2O3S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | piperidin-4-yl N-(4-methylsulfinylbutyl)carbamodithioate;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)CCCCNC(=S)SC1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H22N2OS3.C2HF3O2/c1-17(14)9-3-2-6-13-11(15)16-10-4-7-12-8-5-10;3-2(4,5)1(6)7/h10,12H,2-9H2,1H3,(H,13,15);(H,6,7) |
| InChIKey | MOPCMISSRVOZBJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|