C25H19N3OS — CID 155514176
3-ethyl-7-pyridin-4-yl-N-quinolin-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 155514176) has the molecular formula C25H19N3OS and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-ethyl-7-pyridin-4-yl-N-quinolin-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-ethyl-7-pyridin-4-yl-N-quinolin-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 155514176 |
| Molecular Formula | C25H19N3OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 3-ethyl-7-pyridin-4-yl-N-quinolin-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc3ccccc3n2)sc2c(-c3ccncc3)cccc12 |
| InChI | InChI=1S/C25H19N3OS/c1-2-18-20-8-5-7-19(16-12-14-26-15-13-16)23(20)30-24(18)25(29)28-22-11-10-17-6-3-4-9-21(17)27-22/h3-15H,2H2,1H3,(H,27,28,29) |
| InChIKey | KCIGPPBFZFFUJR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |