C17H24BrFN8O4S — CID 155514212
N'-(3-bromo-4-fluorophenyl)-4-[2-[5-[2-(dimethylamino)ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155514212) has the molecular formula C17H24BrFN8O4S and a molecular weight of 535.40 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-[5-[2-(dimethylamino)ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[5-[2-(dimethylamino)ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155514212 |
| Molecular Formula | C17H24BrFN8O4S |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[5-[2-(dimethylamino)ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CN(C)CCN1CCN(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)S1(=O)=O |
| InChI | InChI=1S/C17H24BrFN8O4S/c1-25(2)7-8-27-10-9-26(32(27,29)30)6-5-20-16-15(23-31-24-16)17(22-28)21-12-3-4-14(19)13(18)11-12/h3-4,11,28H,5-10H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | UOARXWGUGPMRED-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|