C40H40Cl2FN5O5 — CID 155514257
CID 155514257 (PubChem CID 155514257) has the molecular formula C40H40Cl2FN5O5 and a molecular weight of 760.69 g/mol.
| Compound Name | CID 155514257 |
|---|---|
| PubChem CID | 155514257 |
| Molecular Formula | C40H40Cl2FN5O5 |
| Molecular Weight | 760.69 g/mol |
| Exact Mass | 759.24 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(CCCCNC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4cccc(Cl)c4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H40Cl2FN5O5/c41-23-13-14-27-29(20-23)45-38(53)40(27)32(25-11-7-12-28(42)33(25)43)34(47-39(40)17-3-1-4-18-39)36(51)44-19-5-2-8-22-9-6-10-24-26(22)21-48(37(24)52)30-15-16-31(49)46-35(30)50/h6-7,9-14,20,30,32,34,47H,1-5,8,15-19,21H2,(H,44,51)(H,45,53)(H,46,49,50)/t30?,32-,34+,40+/m0/s1 |
| InChIKey | BARRRGHJVPGEOB-AKXSFRSWSA-N |
| XLogP | 5.68 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|