C22H21F5N4S — CID 155514293
N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidin-4-amine (PubChem CID 155514293) has the molecular formula C22H21F5N4S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidin-4-amine.
| Compound Name | N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 155514293 |
| Molecular Formula | C22H21F5N4S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-1-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidin-4-amine |
| SMILES | Fc1ccc([C@@H]2C[C@H]2NC2CCN(c3ncnc4sc(CC(F)(F)F)cc34)CC2)cc1F |
| InChI | InChI=1S/C22H21F5N4S/c23-17-2-1-12(7-18(17)24)15-9-19(15)30-13-3-5-31(6-4-13)20-16-8-14(10-22(25,26)27)32-21(16)29-11-28-20/h1-2,7-8,11,13,15,19,30H,3-6,9-10H2/t15-,19+/m0/s1 |
| InChIKey | UMJCBFYGROAHDJ-HNAYVOBHSA-N |
| XLogP | 5.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |