C18H10BrCl2N5O2 — CID 155514329
4-[[5-bromo-1-(4-chlorophenyl)-2-hydroxyindol-3-yl]diazenyl]-5-chloro-1H-pyridazin-6-one (PubChem CID 155514329) has the molecular formula C18H10BrCl2N5O2 and a molecular weight of 479.12 g/mol. Its IUPAC name is 4-[[5-bromo-1-(4-chlorophenyl)-2-hydroxyindol-3-yl]diazenyl]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[[5-bromo-1-(4-chlorophenyl)-2-hydroxyindol-3-yl]diazenyl]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 155514329 |
| Molecular Formula | C18H10BrCl2N5O2 |
| Molecular Weight | 479.12 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | 4-[[5-bromo-1-(4-chlorophenyl)-2-hydroxyindol-3-yl]diazenyl]-5-chloro-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(/N=N/c2c(O)n(-c3ccc(Cl)cc3)c3ccc(Br)cc23)c1Cl |
| InChI | InChI=1S/C18H10BrCl2N5O2/c19-9-1-6-14-12(7-9)16(24-23-13-8-22-25-17(27)15(13)21)18(28)26(14)11-4-2-10(20)3-5-11/h1-8,28H,(H,25,27)/b24-23+ |
| InChIKey | UXLLLEVXVVFEGG-WCWDXBQESA-N |
| XLogP | 5.90 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.12 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|