C16H23BrFN6O4P — CID 155514339
N'-(3-bromo-4-fluorophenyl)-4-[2-[[ethoxy(propyl)phosphoryl]amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155514339) has the molecular formula C16H23BrFN6O4P and a molecular weight of 493.27 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-[[ethoxy(propyl)phosphoryl]amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[[ethoxy(propyl)phosphoryl]amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155514339 |
| Molecular Formula | C16H23BrFN6O4P |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[[ethoxy(propyl)phosphoryl]amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCCP(=O)(NCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)OCC |
| InChI | InChI=1S/C16H23BrFN6O4P/c1-3-9-29(26,27-4-2)20-8-7-19-15-14(23-28-24-15)16(22-25)21-11-5-6-13(18)12(17)10-11/h5-6,10,25H,3-4,7-9H2,1-2H3,(H,19,24)(H,20,26)(H,21,22) |
| InChIKey | JGULHMRDPBPKRM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|