C21H25N3O2 — CID 155514397
(NZ)-N-[(12aS)-2-methoxy-7,7,9,12a-tetramethyl-6a,12-dihydro-6H-naphtho[1,2-g]quinazolin-5-ylidene]hydroxylamine (PubChem CID 155514397) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (NZ)-N-[(12aS)-2-methoxy-7,7,9,12a-tetramethyl-6a,12-dihydro-6H-naphtho[1,2-g]quinazolin-5-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(12aS)-2-methoxy-7,7,9,12a-tetramethyl-6a,12-dihydro-6H-naphtho[1,2-g]quinazolin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 155514397 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (NZ)-N-[(12aS)-2-methoxy-7,7,9,12a-tetramethyl-6a,12-dihydro-6H-naphtho[1,2-g]quinazolin-5-ylidene]hydroxylamine |
| SMILES | COc1ccc2c(c1)[C@@]1(C)Cc3cnc(C)nc3C(C)(C)C1C/C2=N/O |
| InChI | InChI=1S/C21H25N3O2/c1-12-22-11-13-10-21(4)16-8-14(26-5)6-7-15(16)17(24-25)9-18(21)20(2,3)19(13)23-12/h6-8,11,18,25H,9-10H2,1-5H3/b24-17-/t18?,21-/m1/s1 |
| InChIKey | MZXWRHMWEWSWKY-KNHIJQPASA-N |
| XLogP | 3.78 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|