About [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate
[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 155514624) has the molecular formula C23H25F3N2O5S
and a molecular weight of 498.52 g/mol. Its IUPAC name is [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate |
| PubChem CID | 155514624 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | O=C(Oc1cccc(N2CCS(=O)(=O)CC2)c1)N1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H25F3N2O5S/c24-23(25,26)33-20-6-4-17(5-7-20)18-8-10-28(11-9-18)22(29)32-21-3-1-2-19(16-21)27-12-14-34(30,31)15-13-27/h1-7,16,18H,8-15H2 |
| InChIKey | ARRTYWASSCXELN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate?
The IUPAC name of [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate (CID 155514624) is [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate.
What is the SMILES notation for [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate?
The canonical SMILES for [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate is O=C(Oc1cccc(N2CCS(=O)(=O)CC2)c1)N1CCC(c2ccc(OC(F)(F)F)cc2)CC1.
What is the InChIKey of [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate?
The InChIKey is ARRTYWASSCXELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F3N2O5S/c24-23(25,26)33-20-6-4-17(5-7-20)18-8-10-28(11-9-18)22(29)32-21-3-1-2-19(16-21)27-12-14-34(30,31)15-13-27/h1-7,16,18H,8-15H2.
What are the key properties of [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate?
[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate has a molecular weight of 498.52 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl] 4-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxylate is sourced from PubChem (CID 155514624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).