C23H30N4O — CID 155514642
(1E,3E,6E,8E)-1,9-bis(1-butan-2-ylimidazol-2-yl)nona-1,3,6,8-tetraen-5-one (PubChem CID 155514642) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (1E,3E,6E,8E)-1,9-bis(1-butan-2-ylimidazol-2-yl)nona-1,3,6,8-tetraen-5-one.
| Compound Name | (1E,3E,6E,8E)-1,9-bis(1-butan-2-ylimidazol-2-yl)nona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 155514642 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1E,3E,6E,8E)-1,9-bis(1-butan-2-ylimidazol-2-yl)nona-1,3,6,8-tetraen-5-one |
| SMILES | CCC(C)n1ccnc1/C=C/C=C/C(=O)/C=C/C=C/c1nccn1C(C)CC |
| InChI | InChI=1S/C23H30N4O/c1-5-19(3)26-17-15-24-22(26)13-9-7-11-21(28)12-8-10-14-23-25-16-18-27(23)20(4)6-2/h7-20H,5-6H2,1-4H3/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | CMLBOTMXFVYGFF-DQVHGGFXSA-N |
| XLogP | 5.43 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|