C48H36Br2N8O2 — CID 155514724
2-N,9-N-bis[(E)-(1-benzylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide dibromide (PubChem CID 155514724) has the molecular formula C48H36Br2N8O2 and a molecular weight of 916.68 g/mol. Its IUPAC name is 2-N,9-N-bis[(E)-(1-benzylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide dibromide.
| Compound Name | 2-N,9-N-bis[(E)-(1-benzylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide dibromide |
|---|---|
| PubChem CID | 155514724 |
| Molecular Formula | C48H36Br2N8O2 |
| Molecular Weight | 916.68 g/mol |
| Exact Mass | 914.13 |
| IUPAC Name | 2-N,9-N-bis[(E)-(1-benzylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide dibromide |
| SMILES | O=C(N/N=C/c1ccc2c(ccc[n+]2Cc2ccccc2)c1)c1ccc2ccc3ccc(C(=O)N/N=C/c4ccc5c(ccc[n+]5Cc5ccccc5)c4)nc3c2n1.[Br-].[Br-] |
| InChI | InChI=1S/C48H34N8O2.2BrH/c57-47(53-49-29-35-15-23-43-39(27-35)13-7-25-55(43)31-33-9-3-1-4-10-33)41-21-19-37-17-18-38-20-22-42(52-46(38)45(37)51-41)48(58)54-50-30-36-16-24-44-40(28-36)14-8-26-56(44)32-34-11-5-2-6-12-34;;/h1-30H,31-32H2;2*1H/b49-29+,50-30+;; |
| InChIKey | SPUMSSLXSJRJIN-OHPGBXRISA-N |
| XLogP | 1.30 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|