About 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile
4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile (PubChem CID 155514728) has the molecular formula C18H14FN3
and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile |
| PubChem CID | 155514728 |
| Molecular Formula | C18H14FN3 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile |
| SMILES | Cc1nn(-c2ccc(C#N)cc2)c(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3/c1-12-18(15-5-7-16(19)8-6-15)13(2)22(21-12)17-9-3-14(11-20)4-10-17/h3-10H,1-2H3 |
| InChIKey | DHXMHJZTKWGKCL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile?
The IUPAC name of 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile (CID 155514728) is 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile?
The canonical SMILES for 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile is Cc1nn(-c2ccc(C#N)cc2)c(C)c1-c1ccc(F)cc1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile?
The InChIKey is DHXMHJZTKWGKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3/c1-12-18(15-5-7-16(19)8-6-15)13(2)22(21-12)17-9-3-14(11-20)4-10-17/h3-10H,1-2H3.
What are the key properties of 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile?
4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile has a molecular weight of 291.33 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-3,5-dimethylpyrazol-1-yl]benzonitrile is sourced from PubChem (CID 155514728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).