C25H18ClN5O2S — CID 155514748
2-[[1-[(5-chloro-2-thiophen-2-yl-7,8-dihydroquinolin-6-yl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 155514748) has the molecular formula C25H18ClN5O2S and a molecular weight of 487.97 g/mol. Its IUPAC name is 2-[[1-[(5-chloro-2-thiophen-2-yl-7,8-dihydroquinolin-6-yl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[(5-chloro-2-thiophen-2-yl-7,8-dihydroquinolin-6-yl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155514748 |
| Molecular Formula | C25H18ClN5O2S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 2-[[1-[(5-chloro-2-thiophen-2-yl-7,8-dihydroquinolin-6-yl)methyl]triazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cn(CC2=C(Cl)c3ccc(-c4cccs4)nc3CC2)nn1 |
| InChI | InChI=1S/C25H18ClN5O2S/c26-23-15(7-9-20-19(23)8-10-21(27-20)22-6-3-11-34-22)12-30-13-16(28-29-30)14-31-24(32)17-4-1-2-5-18(17)25(31)33/h1-6,8,10-11,13H,7,9,12,14H2 |
| InChIKey | XFLCOSYACJEXCA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|