About methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate
methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate (PubChem CID 155514785) has the molecular formula C23H18F3NO2S
and a molecular weight of 429.46 g/mol. Its IUPAC name is methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate |
| PubChem CID | 155514785 |
| Molecular Formula | C23H18F3NO2S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C(CC(F)(F)F)c3cccs3)c(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C23H18F3NO2S/c1-29-22(28)15-9-10-16-18(12-15)27-21(14-6-3-2-4-7-14)20(16)17(13-23(24,25)26)19-8-5-11-30-19/h2-12,17,27H,13H2,1H3 |
| InChIKey | MMQZODPLDCMCIS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate?
The IUPAC name of methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate (CID 155514785) is methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate?
The canonical SMILES for methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate is COC(=O)c1ccc2c(C(CC(F)(F)F)c3cccs3)c(-c3ccccc3)[nH]c2c1.
What is the InChIKey of methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate?
The InChIKey is MMQZODPLDCMCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3NO2S/c1-29-22(28)15-9-10-16-18(12-15)27-21(14-6-3-2-4-7-14)20(16)17(13-23(24,25)26)19-8-5-11-30-19/h2-12,17,27H,13H2,1H3.
What are the key properties of methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate?
methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate has a molecular weight of 429.46 g/mol, XLogP of 6.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenyl-3-(3,3,3-trifluoro-1-thiophen-2-ylpropyl)-1H-indole-6-carboxylate is sourced from PubChem (CID 155514785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).