About 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one
3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one (PubChem CID 155514834) has the molecular formula C19H15FN2O
and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one.
Molecular Properties
| Compound Name | 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one |
| PubChem CID | 155514834 |
| Molecular Formula | C19H15FN2O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one |
| SMILES | CCn1ccc2c3c(=O)cc(-c4ccccc4F)[nH]c3ccc21 |
| InChI | InChI=1S/C19H15FN2O/c1-2-22-10-9-13-17(22)8-7-15-19(13)18(23)11-16(21-15)12-5-3-4-6-14(12)20/h3-11H,2H2,1H3,(H,21,23) |
| InChIKey | FKBFGJMRWTXCOT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one?
The IUPAC name of 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one (CID 155514834) is 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one.
What is the SMILES notation for 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one?
The canonical SMILES for 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one is CCn1ccc2c3c(=O)cc(-c4ccccc4F)[nH]c3ccc21.
What is the InChIKey of 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one?
The InChIKey is FKBFGJMRWTXCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN2O/c1-2-22-10-9-13-17(22)8-7-15-19(13)18(23)11-16(21-15)12-5-3-4-6-14(12)20/h3-11H,2H2,1H3,(H,21,23).
What are the key properties of 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one?
3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one has a molecular weight of 306.34 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-(2-fluorophenyl)-6H-pyrrolo[3,2-f]quinolin-9-one is sourced from PubChem (CID 155514834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).