About CID 155514901
CID 155514901 (PubChem CID 155514901) has the molecular formula C26H30N7O5
and a molecular weight of 520.57 g/mol.
Molecular Properties
| Compound Name | CID 155514901 |
| PubChem CID | 155514901 |
| Molecular Formula | C26H30N7O5 |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4cccc(O)c4)n3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C26H30N7O5/c1-25(2)13-19(14-26(3,4)33(25)38)29-23(35)16-8-10-17(11-9-16)30-24-27-15-21(32(36)37)22(31-24)28-18-6-5-7-20(34)12-18/h5-12,15,19,34H,13-14H2,1-4H3,(H,29,35)(H2,27,28,30,31) |
| InChIKey | IDGLADROFDGGQO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 155514901 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155514901?
The IUPAC name of CID 155514901 (CID 155514901) is not available.
What is the SMILES notation for CID 155514901?
The canonical SMILES for CID 155514901 is CC1(C)CC(NC(=O)c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4cccc(O)c4)n3)cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 155514901?
The InChIKey is IDGLADROFDGGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N7O5/c1-25(2)13-19(14-26(3,4)33(25)38)29-23(35)16-8-10-17(11-9-16)30-24-27-15-21(32(36)37)22(31-24)28-18-6-5-7-20(34)12-18/h5-12,15,19,34H,13-14H2,1-4H3,(H,29,35)(H2,27,28,30,31).
What are the key properties of CID 155514901?
CID 155514901 has a molecular weight of 520.57 g/mol, XLogP of 4.67, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155514901 is sourced from PubChem (CID 155514901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).