C13H17ClN2 — CID 155514905
(1R,2R,3S,4S)-3-(6-chloro-3-pyridinyl)-N-methylbicyclo[2.2.1]heptan-2-amine (PubChem CID 155514905) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-(6-chloro-3-pyridinyl)-N-methylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,3S,4S)-3-(6-chloro-3-pyridinyl)-N-methylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 155514905 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (1R,2R,3S,4S)-3-(6-chloro-3-pyridinyl)-N-methylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CN[C@@H]1[C@@H]2CC[C@@H](C2)[C@H]1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H17ClN2/c1-15-13-9-3-2-8(6-9)12(13)10-4-5-11(14)16-7-10/h4-5,7-9,12-13,15H,2-3,6H2,1H3/t8-,9+,12-,13+/m0/s1 |
| InChIKey | JBQVUHZBUWPGOC-GAQJKIJGSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|