C17H19ClN4O — CID 155514910
5-(4-chlorophenyl)-2-hexyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 155514910) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-hexyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(4-chlorophenyl)-2-hexyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155514910 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-hexyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCCCc1nc2nc(-c3ccc(Cl)cc3)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C17H19ClN4O/c1-2-3-4-5-6-15-20-17-19-14(11-16(23)22(17)21-15)12-7-9-13(18)10-8-12/h7-11H,2-6H2,1H3,(H,19,20,21) |
| InChIKey | KMFLBMIWAPYCHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|