C26H40N2O2 — CID 155514921
butyl 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 155514921) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is butyl 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | butyl 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 155514921 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | butyl 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | CCCCOC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1ccccc1)[C@@H]23 |
| InChI | InChI=1S/C26H40N2O2/c1-2-3-18-30-25(29)15-7-14-24-23-13-9-17-27-16-8-12-22(26(23)27)20-28(24)19-21-10-5-4-6-11-21/h4-6,10-11,22-24,26H,2-3,7-9,12-20H2,1H3/t22-,23+,24+,26-/m0/s1 |
| InChIKey | NUHAUYISOJXQFM-WSKLTFMVSA-N |
| XLogP | 4.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|