C16H16N8O3S2 — CID 155514935
1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylthiourea (PubChem CID 155514935) has the molecular formula C16H16N8O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 155514935 |
| Molecular Formula | C16H16N8O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylthiourea |
| SMILES | Nc1nc(C(=O)NNC(=S)Nc2ccccc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N8O3S2/c17-15-20-13(14(25)21-22-16(28)19-10-4-2-1-3-5-10)23-24(15)11-6-8-12(9-7-11)29(18,26)27/h1-9H,(H,21,25)(H2,17,20,23)(H2,18,26,27)(H2,19,22,28) |
| InChIKey | FVXJSGNVKFSEIK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|