C16H23FN4O2 — CID 155514979
N'-(6-fluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 155514979) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is N'-(6-fluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(6-fluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 155514979 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N'-(6-fluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Nc2ccc(F)nc2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H23FN4O2/c1-15(2)7-11(8-16(3,4)21-15)20-14(23)13(22)19-10-5-6-12(17)18-9-10/h5-6,9,11,21H,7-8H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | SFKXUGZADXKGDM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|