C26H38O8 — CID 155515123
[(1R,2R,4aS,5R,8aS)-2-acetyloxy-5-[2-[(4S)-4-acetyloxy-2-oxooxolan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 155515123) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8aS)-2-acetyloxy-5-[2-[(4S)-4-acetyloxy-2-oxooxolan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4aS,5R,8aS)-2-acetyloxy-5-[2-[(4S)-4-acetyloxy-2-oxooxolan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 155515123 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [(1R,2R,4aS,5R,8aS)-2-acetyloxy-5-[2-[(4S)-4-acetyloxy-2-oxooxolan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CC[C@@H]2[C@](C)(COC(C)=O)[C@H](OC(C)=O)CC[C@@]2(C)[C@@H]1CCC1C(=O)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O8/c1-15-7-10-22-25(5,12-11-23(34-18(4)29)26(22,6)14-32-16(2)27)20(15)9-8-19-21(33-17(3)28)13-31-24(19)30/h19-23H,1,7-14H2,2-6H3/t19?,20-,21-,22+,23-,25+,26+/m1/s1 |
| InChIKey | DYMFSJLNXUUSHN-LYFDTUCRSA-N |
| XLogP | 3.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|