C30H24N4O2S — CID 155515132
2-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(4-methylphenyl)sulfonylbenzimidazole (PubChem CID 155515132) has the molecular formula C30H24N4O2S and a molecular weight of 504.62 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(4-methylphenyl)sulfonylbenzimidazole.
| Compound Name | 2-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(4-methylphenyl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 155515132 |
| Molecular Formula | C30H24N4O2S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-1-(4-methylphenyl)sulfonylbenzimidazole |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2-c2nc3ccccc3n2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H24N4O2S/c1-21-12-16-23(17-13-21)29-26(20-33(32-29)24-8-4-3-5-9-24)30-31-27-10-6-7-11-28(27)34(30)37(35,36)25-18-14-22(2)15-19-25/h3-20H,1-2H3 |
| InChIKey | ITGGKMLLLZYUSB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |