C38H45N5O2 — CID 155515351
2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]benzimidazole-5-carboxamide (PubChem CID 155515351) has the molecular formula C38H45N5O2 and a molecular weight of 603.81 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155515351 |
| Molecular Formula | C38H45N5O2 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.36 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-1-(3-methylbutyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(Cc2nc3cc(C(=O)NCCCNc4c5c(nc6ccccc46)CCCC5)ccc3n2CCC(C)C)cc1 |
| InChI | InChI=1S/C38H45N5O2/c1-4-45-29-17-14-27(15-18-29)24-36-42-34-25-28(16-19-35(34)43(36)23-20-26(2)3)38(44)40-22-9-21-39-37-30-10-5-7-12-32(30)41-33-13-8-6-11-31(33)37/h5,7,10,12,14-19,25-26H,4,6,8-9,11,13,20-24H2,1-3H3,(H,39,41)(H,40,44) |
| InChIKey | GMPFGFALXNLDAY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|