C19H21N7OSSe2 — CID 155515367
N-[5-[2-[2-(5-amino-1,3,4-selenadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-selenadiazol-2-yl]-2-(1-methylindol-3-yl)acetamide (PubChem CID 155515367) has the molecular formula C19H21N7OSSe2 and a molecular weight of 553.41 g/mol. Its IUPAC name is N-[5-[2-[2-(5-amino-1,3,4-selenadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-selenadiazol-2-yl]-2-(1-methylindol-3-yl)acetamide.
| Compound Name | N-[5-[2-[2-(5-amino-1,3,4-selenadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-selenadiazol-2-yl]-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 155515367 |
| Molecular Formula | C19H21N7OSSe2 |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | N-[5-[2-[2-(5-amino-1,3,4-selenadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-selenadiazol-2-yl]-2-(1-methylindol-3-yl)acetamide |
| SMILES | Cn1cc(CC(=O)Nc2nnc(CCSCCc3nnc(N)[se]3)[se]2)c2ccccc21 |
| InChI | InChI=1S/C19H21N7OSSe2/c1-26-11-12(13-4-2-3-5-14(13)26)10-15(27)21-19-25-23-17(30-19)7-9-28-8-6-16-22-24-18(20)29-16/h2-5,11H,6-10H2,1H3,(H2,20,24)(H,21,25,27) |
| InChIKey | KHBFOXPPERCDLP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|