About ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate
ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate (PubChem CID 155515550) has the molecular formula C22H26O7
and a molecular weight of 402.44 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate |
| PubChem CID | 155515550 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate |
| SMILES | C=C(c1ccc(OC)c(OCC(=O)OCC)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26O7/c1-7-28-21(23)13-29-18-10-15(8-9-17(18)24-3)14(2)16-11-19(25-4)22(27-6)20(12-16)26-5/h8-12H,2,7,13H2,1,3-6H3 |
| InChIKey | RAWXFWNCZZFPEM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate?
The IUPAC name of ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate (CID 155515550) is ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate.
What is the SMILES notation for ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate?
The canonical SMILES for ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate is C=C(c1ccc(OC)c(OCC(=O)OCC)c1)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate?
The InChIKey is RAWXFWNCZZFPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O7/c1-7-28-21(23)13-29-18-10-15(8-9-17(18)24-3)14(2)16-11-19(25-4)22(27-6)20(12-16)26-5/h8-12H,2,7,13H2,1,3-6H3.
What are the key properties of ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate?
ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate has a molecular weight of 402.44 g/mol, XLogP of 3.72, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-methoxy-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]acetate is sourced from PubChem (CID 155515550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).