C29H28F2N2O3 — CID 155515575
2,6-difluoro-N-[(2S)-1-oxo-1-[[(E,3S)-6-oxo-1-phenylhept-4-en-3-yl]amino]-3-phenylpropan-2-yl]benzamide (PubChem CID 155515575) has the molecular formula C29H28F2N2O3 and a molecular weight of 490.55 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2S)-1-oxo-1-[[(E,3S)-6-oxo-1-phenylhept-4-en-3-yl]amino]-3-phenylpropan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2S)-1-oxo-1-[[(E,3S)-6-oxo-1-phenylhept-4-en-3-yl]amino]-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 155515575 |
| Molecular Formula | C29H28F2N2O3 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2,6-difluoro-N-[(2S)-1-oxo-1-[[(E,3S)-6-oxo-1-phenylhept-4-en-3-yl]amino]-3-phenylpropan-2-yl]benzamide |
| SMILES | CC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C29H28F2N2O3/c1-20(34)15-17-23(18-16-21-9-4-2-5-10-21)32-28(35)26(19-22-11-6-3-7-12-22)33-29(36)27-24(30)13-8-14-25(27)31/h2-15,17,23,26H,16,18-19H2,1H3,(H,32,35)(H,33,36)/b17-15+/t23-,26+/m1/s1 |
| InChIKey | JJGHCGAGHCPPMU-SDQZRDCKSA-N |
| XLogP | 4.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|