C28H28O8 — CID 155515607
[(1S,2S)-2-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-2-[[(1S,3S,4R,5S)-7-oxo-3-phenyl-2,6-dioxabicyclo[3.3.1]nonan-4-yl]oxy]-1-phenylethyl] acetate (PubChem CID 155515607) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is [(1S,2S)-2-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-2-[[(1S,3S,4R,5S)-7-oxo-3-phenyl-2,6-dioxabicyclo[3.3.1]nonan-4-yl]oxy]-1-phenylethyl] acetate.
| Compound Name | [(1S,2S)-2-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-2-[[(1S,3S,4R,5S)-7-oxo-3-phenyl-2,6-dioxabicyclo[3.3.1]nonan-4-yl]oxy]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 155515607 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [(1S,2S)-2-[(2S)-6-oxo-2,3-dihydropyran-2-yl]-2-[[(1S,3S,4R,5S)-7-oxo-3-phenyl-2,6-dioxabicyclo[3.3.1]nonan-4-yl]oxy]-1-phenylethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccccc1)[C@@H](O[C@@H]1[C@@H]2C[C@@H](CC(=O)O2)O[C@H]1c1ccccc1)[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C28H28O8/c1-17(29)32-25(18-9-4-2-5-10-18)27(21-13-8-14-23(30)34-21)36-28-22-15-20(16-24(31)35-22)33-26(28)19-11-6-3-7-12-19/h2-12,14,20-22,25-28H,13,15-16H2,1H3/t20-,21-,22-,25-,26-,27-,28+/m0/s1 |
| InChIKey | XIBVVAIWCCINAK-WSRKESHLSA-N |
| XLogP | 3.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|