C19H11ClN4O2S — CID 155515618
3-[6-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one (PubChem CID 155515618) has the molecular formula C19H11ClN4O2S and a molecular weight of 394.84 g/mol. Its IUPAC name is 3-[6-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one.
| Compound Name | 3-[6-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 155515618 |
| Molecular Formula | C19H11ClN4O2S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 3-[6-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nnc2n1N=C(c1ccc(Cl)cc1)CS2 |
| InChI | InChI=1S/C19H11ClN4O2S/c20-13-7-5-11(6-8-13)15-10-27-19-22-21-17(24(19)23-15)14-9-12-3-1-2-4-16(12)26-18(14)25/h1-9H,10H2 |
| InChIKey | BDRVSODDJIUMRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|