C22H24N2O4 — CID 155515678
(3E,5E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one (PubChem CID 155515678) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3E,5E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 155515678 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (3E,5E)-1-methyl-3-(pyridin-4-ylmethylidene)-5-[(2,3,4-trimethoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1ccc(/C=C2\CN(C)C/C(=C\c3ccncc3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C22H24N2O4/c1-24-13-17(11-15-7-9-23-10-8-15)20(25)18(14-24)12-16-5-6-19(26-2)22(28-4)21(16)27-3/h5-12H,13-14H2,1-4H3/b17-11+,18-12+ |
| InChIKey | ZXRGDHZTKDGBHJ-JYFOCSDGSA-N |
| XLogP | 3.09 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|