C36H30N4O6 — CID 155515696
2-[3-[15-[3-(carboxymethoxy)phenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]phenoxy]acetic acid (PubChem CID 155515696) has the molecular formula C36H30N4O6 and a molecular weight of 614.66 g/mol. Its IUPAC name is 2-[3-[15-[3-(carboxymethoxy)phenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[15-[3-(carboxymethoxy)phenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155515696 |
| Molecular Formula | C36H30N4O6 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 2-[3-[15-[3-(carboxymethoxy)phenyl]-2,3,12,13,22,24-hexahydroporphyrin-5-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(OCC(=O)O)c4)c4nc(cc5ccc2[nH]5)CC4)CC3)c1 |
| InChI | InChI=1S/C36H30N4O6/c41-33(42)19-45-27-5-1-3-21(15-27)35-29-11-7-23(37-29)17-25-9-13-31(39-25)36(22-4-2-6-28(16-22)46-20-34(43)44)32-14-10-26(40-32)18-24-8-12-30(35)38-24/h1-7,10-11,14-18,37,40H,8-9,12-13,19-20H2,(H,41,42)(H,43,44)/b23-17-,24-18-,25-17-,26-18-,35-29-,35-30-,36-31-,36-32- |
| InChIKey | BWOBSVQQYPGBAT-JPKOYWFQSA-N |
| XLogP | 6.15 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |