C20H13F2N3O2S — CID 155515940
7-(4-fluorophenyl)-2-[(6-fluoro-3-pyridinyl)oxymethyl]thieno[3,2-b]pyridine-5-carboxamide (PubChem CID 155515940) has the molecular formula C20H13F2N3O2S and a molecular weight of 397.41 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-2-[(6-fluoro-3-pyridinyl)oxymethyl]thieno[3,2-b]pyridine-5-carboxamide.
| Compound Name | 7-(4-fluorophenyl)-2-[(6-fluoro-3-pyridinyl)oxymethyl]thieno[3,2-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155515940 |
| Molecular Formula | C20H13F2N3O2S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 7-(4-fluorophenyl)-2-[(6-fluoro-3-pyridinyl)oxymethyl]thieno[3,2-b]pyridine-5-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2)c2sc(COc3ccc(F)nc3)cc2n1 |
| InChI | InChI=1S/C20H13F2N3O2S/c21-12-3-1-11(2-4-12)15-8-17(20(23)26)25-16-7-14(28-19(15)16)10-27-13-5-6-18(22)24-9-13/h1-9H,10H2,(H2,23,26) |
| InChIKey | ZLJDDVKDWWNBCA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|