C25H25N5O3S — CID 155515949
3-[4-(6-amino-3-pyridinyl)phenyl]-N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]propanamide (PubChem CID 155515949) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-[4-(6-amino-3-pyridinyl)phenyl]-N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]propanamide.
| Compound Name | 3-[4-(6-amino-3-pyridinyl)phenyl]-N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 155515949 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-[4-(6-amino-3-pyridinyl)phenyl]-N-[2-(isoquinolin-5-ylsulfonylamino)ethyl]propanamide |
| SMILES | Nc1ccc(-c2ccc(CCC(=O)NCCNS(=O)(=O)c3cccc4cnccc34)cc2)cn1 |
| InChI | InChI=1S/C25H25N5O3S/c26-24-10-9-20(17-29-24)19-7-4-18(5-8-19)6-11-25(31)28-14-15-30-34(32,33)23-3-1-2-21-16-27-13-12-22(21)23/h1-5,7-10,12-13,16-17,30H,6,11,14-15H2,(H2,26,29)(H,28,31) |
| InChIKey | HZBOLJUTBMTYPF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|